Products 136450-11-8

CAS 136450-11-8 appears in our catalog under these names: Pranlukast Impurity 5, Pranlukast Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

N-(2-cyano-4-oxochromen-8-yl)-4-(4-phenylbutoxy)benzamide (CAS 136450-11-8) is a chemical compound with the molecular formula C27H22N2O4 and a molecular weight of 438.5 g/mol. IUPAC name: N-(2-cyano-4-oxochromen-8-yl)-4-(4-phenylbutoxy)benzamide. InChIKey: ANMRPVKNZDBSIX-UHFFFAOYSA-N.

Identity
Molecular formulaC27H22N2O4
Molecular weight438.5 g/mol
IUPAC nameN-(2-cyano-4-oxochromen-8-yl)-4-(4-phenylbutoxy)benzamide
InChIKeyANMRPVKNZDBSIX-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCCCOC2=CC=C(C=C2)C(=O)NC3=CC=CC4=C3OC(=CC4=O)C#N

Computed by PubChem (NCBI)