CAS 214852-56-9 appears in our catalog under these names: Fmoc-beta-(2-quinolyl)-ala-oh, 95%, Fmoc–β–(2–quinolyl)–Ala–OH, (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-quinolinepropanoic acid, 98%, 98%, Fmoc-β-(2-quinolyl)-Ala-OH, 98%, Fmoc-β-(2-Quinolyl)-Ala-OH, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 10g, 25g, 50mg, 5g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-2-ylpropanoic acid (CAS 214852-56-9) is a chemical compound with the molecular formula C27H22N2O4 and a molecular weight of 438.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-2-ylpropanoic acid. InChIKey: IDOMHXAHHXHYMO-VWLOTQADSA-N.
| Molecular formula | C27H22N2O4 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-2-ylpropanoic acid |
| InChIKey | IDOMHXAHHXHYMO-VWLOTQADSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)