cas: 42399-49-5 — see every product listed under this CAS number, including other names
(2S,3S)-2,3-Dihydro-3-hydroxy-2-(4-methoxyphenyl)-1,5-benzothiazepin-4(5H)-one, 99%, 99% (CAS 42399-49-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143CI-5g |
| cas | 42399-49-5 |
| size | 5g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 74.00 Pln | |
| Chemat | 100g | 117.20 Pln | |
| Chemat | 500g | 398.40 Pln | |
| Chemat | 1kg | 717.20 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2S,3S)-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CAS 42399-49-5) is a chemical compound with the molecular formula C16H15NO3S and a molecular weight of 301.4 g/mol. IUPAC name: (2S,3S)-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one. InChIKey: LHBHZALHFIQJGJ-CABCVRRESA-N.
| Molecular formula | C16H15NO3S |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | (2S,3S)-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| InChIKey | LHBHZALHFIQJGJ-CABCVRRESA-N |
| SMILES | COC1=CC=C(C=C1)[C@H]2[C@H](C(=O)NC3=CC=CC=C3S2)O |
Computed by PubChem (NCBI)