Products 743453-44-3

CAS 743453-44-3 is the registry number for 2-[(3-Methylbut-2-enoyl)amino]-4-phenylthiophene-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylic acid (CAS 743453-44-3) is a chemical compound with the molecular formula C16H15NO3S and a molecular weight of 301.4 g/mol. IUPAC name: 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylic acid. InChIKey: IGEOTGHPIWCSHX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15NO3S
Molecular weight301.4 g/mol
IUPAC name2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylic acid
InChIKeyIGEOTGHPIWCSHX-UHFFFAOYSA-N
SMILESCC(=CC(=O)NC1=C(C(=CS1)C2=CC=CC=C2)C(=O)O)C

Computed by PubChem (NCBI)