CAS 263389-54-4 appears in our catalog under these names: alfa-(4-Toluenesulfonyl)-4-methoxybenzylisocyanide, 95%, a–Tosyl–(4–methoxybenzyl) isocyanide, a-Tosyl-(4-methoxybenzyl) isocyanide 95%, a-Tosyl-(4-methoxybenzyl) isocyanide, 99%, 99%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
1-[isocyano-(4-methoxyphenyl)methyl]sulfonyl-4-methylbenzene (CAS 263389-54-4) is a chemical compound with the molecular formula C16H15NO3S and a molecular weight of 301.4 g/mol. IUPAC name: 1-[isocyano-(4-methoxyphenyl)methyl]sulfonyl-4-methylbenzene. InChIKey: QIJRGVGFTZWYNF-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3S |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 1-[isocyano-(4-methoxyphenyl)methyl]sulfonyl-4-methylbenzene |
| InChIKey | QIJRGVGFTZWYNF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC=C(C=C2)OC)[N+]#[C-] |
Computed by PubChem (NCBI)