CAS 263389-53-3 appears in our catalog under these names: Isocyano(2-methoxyphenyl)methyl-4-methylphenyl sulfone, 98%, 1-(Isocyano(tosyl)methyl)-2-methoxybenzene, 95%, 95%, 1-(Isocyano(tosyl)methyl)-2-methoxybenzene, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2-methoxybenzene (CAS 263389-53-3) is a chemical compound with the molecular formula C16H15NO3S and a molecular weight of 301.4 g/mol. IUPAC name: 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2-methoxybenzene. InChIKey: BTXVFJYPHAIAST-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3S |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2-methoxybenzene |
| InChIKey | BTXVFJYPHAIAST-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC=CC=C2OC)[N+]#[C-] |
Computed by PubChem (NCBI)