CAS 1255783-92-6 is the registry number for 1-(3-Methylbenzyl)-1h-2,1-benzothiazin-4(3h)-one 2,2-dioxide, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[(3-methylphenyl)methyl]-2,2-dioxo-2lambda6,1-benzothiazin-4-one (CAS 1255783-92-6) is a chemical compound with the molecular formula C16H15NO3S and a molecular weight of 301.4 g/mol. IUPAC name: 1-[(3-methylphenyl)methyl]-2,2-dioxo-2lambda6,1-benzothiazin-4-one. InChIKey: CRPMRQVRDJSRHN-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3S |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 1-[(3-methylphenyl)methyl]-2,2-dioxo-2lambda6,1-benzothiazin-4-one |
| InChIKey | CRPMRQVRDJSRHN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CN2C3=CC=CC=C3C(=O)CS2(=O)=O |
Computed by PubChem (NCBI)