(2S,3S)-2-Methyl-3-((methylsulfonyl)methyl)azetidine hydrochloride, 97%
cas: 2725774-17-2 — see every product listed under this CAS number, including other names
(2S,3S)-2-Methyl-3-((methylsulfonyl)methyl)azetidine hydrochloride, 97% (CAS 2725774-17-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F785717-100MG |
| cas | 2725774-17-2 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1185.02 Pln | |
| Fluorochem | 250mg | 1731.70 Pln | |
| Fluorochem | 500mg | 2825.06 Pln | |
| Fluorochem | 1g | 4433.87 Pln | |
| Fluorochem | 5g | 18392.50 Pln | |
| Fluorochem | 10g | 30601.74 Pln | |
| Chemat | 100mg | 712.40 Pln | |
| Chemat | 250mg | 1038.80 Pln | |
| Chemat | 500mg | 1686.80 Pln | |
| Chemat | 1g | 2661.20 Pln | |
| Chemat | 5g | 11205.20 Pln | |
| Chemat | 10g | 18630.80 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(2S,3S)-2-methyl-3-(methylsulfonylmethyl)azetidine;hydrochloride (CAS 2725774-17-2) is a chemical compound with the molecular formula C6H14ClNO2S and a molecular weight of 199.70 g/mol. IUPAC name: (2S,3S)-2-methyl-3-(methylsulfonylmethyl)azetidine;hydrochloride. InChIKey: IKZNUAOSIURECY-RIHPBJNCSA-N.
| Molecular formula | C6H14ClNO2S |
|---|---|
| Molecular weight | 199.70 g/mol |
| IUPAC name | (2S,3S)-2-methyl-3-(methylsulfonylmethyl)azetidine;hydrochloride |
| InChIKey | IKZNUAOSIURECY-RIHPBJNCSA-N |
| SMILES | C[C@H]1[C@H](CN1)CS(=O)(=O)C.Cl |
Computed by PubChem (NCBI)