CAS 2411591-38-1 is the registry number for (2R,3S)-2-Methyl-3-((methylsulfonyl)methyl)azetidine hydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
(2R,3S)-2-methyl-3-(methylsulfonylmethyl)azetidine;hydrochloride (CAS 2411591-38-1) is a chemical compound with the molecular formula C6H14ClNO2S and a molecular weight of 199.70 g/mol. IUPAC name: (2R,3S)-2-methyl-3-(methylsulfonylmethyl)azetidine;hydrochloride. InChIKey: IKZNUAOSIURECY-KGZKBUQUSA-N.
| Molecular formula | C6H14ClNO2S |
|---|---|
| Molecular weight | 199.70 g/mol |
| IUPAC name | (2R,3S)-2-methyl-3-(methylsulfonylmethyl)azetidine;hydrochloride |
| InChIKey | IKZNUAOSIURECY-KGZKBUQUSA-N |
| SMILES | C[C@@H]1[C@H](CN1)CS(=O)(=O)C.Cl |
Computed by PubChem (NCBI)