CAS 2411592-27-1 appears in our catalog under these names: (2S,3R)-2-Methyl-3-((methylsulfonyl)methyl)azetidine hydrochloride, 98%, (2S,3R)-2-Methyl-3-((methylsulfonyl)methyl)azetidine hydrochloride, 97%, 97%, (2S,3R)-2-Methyl-3-((methylsulfonyl)methyl)azetidine hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
(2S,3R)-2-methyl-3-(methylsulfonylmethyl)azetidine;hydrochloride (CAS 2411592-27-1) is a chemical compound with the molecular formula C6H14ClNO2S and a molecular weight of 199.70 g/mol. IUPAC name: (2S,3R)-2-methyl-3-(methylsulfonylmethyl)azetidine;hydrochloride. InChIKey: IKZNUAOSIURECY-GEMLJDPKSA-N.
| Molecular formula | C6H14ClNO2S |
|---|---|
| Molecular weight | 199.70 g/mol |
| IUPAC name | (2S,3R)-2-methyl-3-(methylsulfonylmethyl)azetidine;hydrochloride |
| InChIKey | IKZNUAOSIURECY-GEMLJDPKSA-N |
| SMILES | C[C@H]1[C@@H](CN1)CS(=O)(=O)C.Cl |
Computed by PubChem (NCBI)