cas: 98737-29-2 — see every product listed under this CAS number, including other names
(2S,3S)-3-(N-BOC-amino)-1-oxirane-4-phenylbutane, 98% (CAS 98737-29-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 395020010 |
| cas | 98737-29-2 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 739.44 Pln | |
| Thermo Scientific (Acros) | 5g | 2552.40 Pln | |
| Thermo Scientific (Acros) | 25g | 9817.61 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
Tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate (CAS 98737-29-2) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate. InChIKey: NVPOUMXZERMIJK-QWHCGFSZSA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate |
| InChIKey | NVPOUMXZERMIJK-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)[C@H]2CO2 |
Computed by PubChem (NCBI)