cas: 98737-29-2 — see every product listed under this CAS number, including other names
(2S,3S)-N-t-Boc-3-amino-1,2-epoxy-4-phenylbutane, 95% (CAS 98737-29-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076757-250MG |
| cas | 98737-29-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 221.81 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 409.25 Pln | |
| Fluorochem | 100g | 997.58 Pln | |
| Fluorochem | 500g | 4652.55 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate (CAS 98737-29-2) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate. InChIKey: NVPOUMXZERMIJK-QWHCGFSZSA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate |
| InChIKey | NVPOUMXZERMIJK-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)[C@H]2CO2 |
Computed by PubChem (NCBI)