cas: 1626394-43-1 — see every product listed under this CAS number, including other names
(2S,3S)-Ethyl 3-aminobicyclo[2.2.2]octane-2-carboxylate hydrochloride 97% (CAS 1626394-43-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A168374-100mg |
| cas | 1626394-43-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 743.06 Pln | |
| Ambeed | 10g | 1416.12 Pln | |
| Ambeed | 25g | 3101.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A168374 |
Ethyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate;hydrochloride (CAS 1626394-43-1) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: ethyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate;hydrochloride. InChIKey: CFRFVTFZTABHIF-UANYXRBSSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | ethyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate;hydrochloride |
| InChIKey | CFRFVTFZTABHIF-UANYXRBSSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H](C2CCC1CC2)N.Cl |
Computed by PubChem (NCBI)