cas: 1626394-43-1 — see every product listed under this CAS number, including other names
(2S,3S)-Ethyl 3-aminobicyclo[2.2.2]octane-2-carboxylate hydrochloride, 97% (CAS 1626394-43-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F517822-250MG |
| cas | 1626394-43-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 2.5g | 508.17 Pln | |
| Fluorochem | 5g | 643.54 Pln | |
| Fluorochem | 10g | 987.17 Pln | |
| Fluorochem | 25g | 1908.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate;hydrochloride (CAS 1626394-43-1) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: ethyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate;hydrochloride. InChIKey: CFRFVTFZTABHIF-UANYXRBSSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | ethyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate;hydrochloride |
| InChIKey | CFRFVTFZTABHIF-UANYXRBSSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H](C2CCC1CC2)N.Cl |
Computed by PubChem (NCBI)