cas: 1626394-43-1 — see every product listed under this CAS number, including other names
(2S,3S)-Ethyl 3-aminobicyclo[2.2.2]octane-2-carboxylate hydrochloride, 98%, 98% (CAS 1626394-43-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112T0V-100mg |
| cas | 1626394-43-1 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 611.60 Pln | |
| Chemat | 25g | 1163.60 Pln | |
| Chemat | 100g | 2541.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate;hydrochloride (CAS 1626394-43-1) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: ethyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate;hydrochloride. InChIKey: CFRFVTFZTABHIF-UANYXRBSSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | ethyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate;hydrochloride |
| InChIKey | CFRFVTFZTABHIF-UANYXRBSSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H](C2CCC1CC2)N.Cl |
Computed by PubChem (NCBI)