cas: 74844-91-0 — see every product listed under this CAS number, including other names
(2S,4R)-1-TERT-BUTYL 2-METHYL 4-HYDROXYPYRROLIDINE-1,2-DICARBOXYLATE, 97%, 97% (CAS 74844-91-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 10kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SU9-5g |
| cas | 74844-91-0 |
| size | 5g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 88.40 Pln | |
| Chemat | 100g | 112.40 Pln | |
| Chemat | 250g | 184.40 Pln | |
| Chemat | 500g | 374.40 Pln | |
| Chemat | 10kg | price on request |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 74844-91-0) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: MZMNEDXVUJLQAF-SFYZADRCSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | MZMNEDXVUJLQAF-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)OC)O |
Computed by PubChem (NCBI)