cas: 74844-91-0 — see every product listed under this CAS number, including other names
Boc-Hyp-OMe, 99.94% (CAS 74844-91-0) is a chemical reagent available from Chemat. Available pack sizes: 250 g, 500 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-65039-250 g |
| cas | 74844-91-0 |
| size | 250 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 250 g | 333.62 Pln | |
| MedChemExpress | 500 g | 496.16 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.94% |
1-O-tert-butyl 2-O-methyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 74844-91-0) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: MZMNEDXVUJLQAF-SFYZADRCSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | MZMNEDXVUJLQAF-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)OC)O |
Computed by PubChem (NCBI)