cas: 203866-18-6 — see every product listed under this CAS number, including other names
(2S,4R)-1-tert-Butyl 2-methyl 4-fluoropyrrolidine-1,2-dicarboxylate, 97%, 97% (CAS 203866-18-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11306M-250mg |
| cas | 203866-18-6 |
| size | 250mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 208.40 Pln | |
| Chemat | 25g | 424.40 Pln | |
| Chemat | 50g | 789.20 Pln | |
| Chemat | 100g | 1509.20 Pln | |
| Chemat | 250g | 3338.00 Pln | |
| Chemat | 1kg | 9405.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl (2S,4R)-4-fluoropyrrolidine-1,2-dicarboxylate (CAS 203866-18-6) is a chemical compound with the molecular formula C11H18FNO4 and a molecular weight of 247.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-fluoropyrrolidine-1,2-dicarboxylate. InChIKey: METPQQHVRNLTRX-SFYZADRCSA-N.
| Molecular formula | C11H18FNO4 |
|---|---|
| Molecular weight | 247.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-fluoropyrrolidine-1,2-dicarboxylate |
| InChIKey | METPQQHVRNLTRX-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)OC)F |
Computed by PubChem (NCBI)