Products 1648910-85-3

CAS 1648910-85-3 is the registry number for 1-tert-Butyl 2-methyl (2r,4s)-4-fluoropyrrolidine-1,2-dicarboxylate, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-methyl (2R,4S)-4-fluoropyrrolidine-1,2-dicarboxylate (CAS 1648910-85-3) is a chemical compound with the molecular formula C11H18FNO4 and a molecular weight of 247.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-fluoropyrrolidine-1,2-dicarboxylate. InChIKey: METPQQHVRNLTRX-JGVFFNPUSA-N.

Identity
Molecular formulaC11H18FNO4
Molecular weight247.26 g/mol
IUPAC name1-O-tert-butyl 2-O-methyl (2R,4S)-4-fluoropyrrolidine-1,2-dicarboxylate
InChIKeyMETPQQHVRNLTRX-JGVFFNPUSA-N
SMILESCC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)OC)F

Computed by PubChem (NCBI)