Products 911469-08-4
CAS 911469-08-4 is the registry number for 1-(tert-Butyl) 2-methyl (2S)-4-fluoropyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 2-O-methyl (2S)-4-fluoropyrrolidine-1,2-dicarboxylate (CAS 911469-08-4) is a chemical compound with the molecular formula C11H18FNO4 and a molecular weight of 247.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-4-fluoropyrrolidine-1,2-dicarboxylate. InChIKey: METPQQHVRNLTRX-MQWKRIRWSA-N.
| Molecular formula | C11H18FNO4 |
|---|---|
| Molecular weight | 247.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-4-fluoropyrrolidine-1,2-dicarboxylate |
| InChIKey | METPQQHVRNLTRX-MQWKRIRWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@H]1C(=O)OC)F |
Computed by PubChem (NCBI)