cas: 1049978-67-7 — see every product listed under this CAS number, including other names
(2S,4R)-4-(2-Nitrobenzyl)pyrrolidine-2-carboxylic acid, 95%, 95% (CAS 1049978-67-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1105XU-100mg |
| cas | 1049978-67-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1442.00 Pln | |
| Chemat | 250mg | 2474.00 Pln | |
| Chemat | 1g | 4888.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S,4R)-4-[(2-nitrophenyl)methyl]pyrrolidine-2-carboxylic acid (CAS 1049978-67-7) is a chemical compound with the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. IUPAC name: (2S,4R)-4-[(2-nitrophenyl)methyl]pyrrolidine-2-carboxylic acid. InChIKey: OETHXWXQNOKWOM-SCZZXKLOSA-N.
| Molecular formula | C12H14N2O4 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | (2S,4R)-4-[(2-nitrophenyl)methyl]pyrrolidine-2-carboxylic acid |
| InChIKey | OETHXWXQNOKWOM-SCZZXKLOSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)