CAS 1189670-48-1 is the registry number for Ethyl 2-(5,6-dimethyl-4-oxofuro[2,3-d]pyrimidin-3(4h)-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 2-(5,6-dimethyl-4-oxofuro[2,3-d]pyrimidin-3-yl)acetate (CAS 1189670-48-1) is a chemical compound with the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. IUPAC name: ethyl 2-(5,6-dimethyl-4-oxofuro[2,3-d]pyrimidin-3-yl)acetate. InChIKey: YPEALRPZMPYFES-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | ethyl 2-(5,6-dimethyl-4-oxofuro[2,3-d]pyrimidin-3-yl)acetate |
| InChIKey | YPEALRPZMPYFES-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C=NC2=C(C1=O)C(=C(O2)C)C |
Computed by PubChem (NCBI)