cas: 170850-75-6 — see every product listed under this CAS number, including other names
(2S,4R)-Di-tert-Butyl 4-hydroxypyrrolidine-1,2-dicarboxylate, 97%, 97% (CAS 170850-75-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AC14-100mg |
| cas | 170850-75-6 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 25g | 5517.20 Pln | |
| Chemat | 5g | 1619.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ditert-butyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 170850-75-6) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: ditert-butyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: OXHIVNUWGSCHBD-ZJUUUORDSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | ditert-butyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | OXHIVNUWGSCHBD-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@H](CN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)