cas: 170850-75-6 — see every product listed under this CAS number, including other names
Boc-Hyp-OtBu 97% (CAS 170850-75-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A352784-100mg |
| cas | 170850-75-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1850.00 Pln | |
| Ambeed | 25g | 6967.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A352784 |
Ditert-butyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 170850-75-6) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: ditert-butyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: OXHIVNUWGSCHBD-ZJUUUORDSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | ditert-butyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | OXHIVNUWGSCHBD-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@H](CN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)