cas: 169032-99-9 — see every product listed under this CAS number, including other names
(2S,4S)-1-tert-Butyl 2-methyl 4-chloropyrrolidine-1,2-dicarboxylate 96% (CAS 169032-99-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A983499-100mg |
| cas | 169032-99-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 893.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A983499 |
1-O-tert-butyl 2-O-methyl (2S,4S)-4-chloropyrrolidine-1,2-dicarboxylate (CAS 169032-99-9) is a chemical compound with the molecular formula C11H18ClNO4 and a molecular weight of 263.72 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4S)-4-chloropyrrolidine-1,2-dicarboxylate. InChIKey: XNKQYQOTERJNHJ-YUMQZZPRSA-N.
| Molecular formula | C11H18ClNO4 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-chloropyrrolidine-1,2-dicarboxylate |
| InChIKey | XNKQYQOTERJNHJ-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)OC)Cl |
Computed by PubChem (NCBI)