cas: 169032-99-9 — see every product listed under this CAS number, including other names
(2S,4S)-1-tert-butyl 2-methyl-4-chloropyrrolidine-1,2-dicarboxylate, 96% (CAS 169032-99-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F080285-250MG |
| cas | 169032-99-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 966.34 Pln | |
| Fluorochem | 1g | 1830.62 Pln | |
| Fluorochem | 5g | 5719.88 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 2-O-methyl (2S,4S)-4-chloropyrrolidine-1,2-dicarboxylate (CAS 169032-99-9) is a chemical compound with the molecular formula C11H18ClNO4 and a molecular weight of 263.72 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4S)-4-chloropyrrolidine-1,2-dicarboxylate. InChIKey: XNKQYQOTERJNHJ-YUMQZZPRSA-N.
| Molecular formula | C11H18ClNO4 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-chloropyrrolidine-1,2-dicarboxylate |
| InChIKey | XNKQYQOTERJNHJ-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)OC)Cl |
Computed by PubChem (NCBI)