cas: 6284-79-3 — see every product listed under this CAS number, including other names
(3,4-Dichlorophenyl)(Phenyl)Methanone, 95%, 95% (CAS 6284-79-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IG6-25g |
| cas | 6284-79-3 |
| size | 25g |
| availability | 700g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 491.60 Pln | |
| Chemat | 500g | 2040.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3,4-dichlorophenyl)-phenylmethanone (CAS 6284-79-3) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (3,4-dichlorophenyl)-phenylmethanone. InChIKey: LLUPHTAYNHAVQT-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (3,4-dichlorophenyl)-phenylmethanone |
| InChIKey | LLUPHTAYNHAVQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)