cas: 6284-79-3 — see every product listed under this CAS number, including other names
(3,4-Dichlorophenyl)(phenyl)methanone (CAS 6284-79-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235693-5G |
| cas | 6284-79-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 25g | 253.05 Pln | |
| Fluorochem | 100g | 789.32 Pln | |
| Fluorochem | 500g | 3236.38 Pln |
| delivery time | 3-4 weeks |
|---|
(3,4-dichlorophenyl)-phenylmethanone (CAS 6284-79-3) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (3,4-dichlorophenyl)-phenylmethanone. InChIKey: LLUPHTAYNHAVQT-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (3,4-dichlorophenyl)-phenylmethanone |
| InChIKey | LLUPHTAYNHAVQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)