cas: 915923-80-7 — see every product listed under this CAS number, including other names
(3,4-Dimethylphenyl)(thiophen-2-yl)methanone 95+% (CAS 915923-80-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A379679-250mg |
| cas | 915923-80-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 2167.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A379679 |
(3,4-dimethylphenyl)-thiophen-2-ylmethanone (CAS 915923-80-7) is a chemical compound with the molecular formula C13H12OS and a molecular weight of 216.30 g/mol. IUPAC name: (3,4-dimethylphenyl)-thiophen-2-ylmethanone. InChIKey: NULMBVQLHKQESS-UHFFFAOYSA-N.
| Molecular formula | C13H12OS |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | (3,4-dimethylphenyl)-thiophen-2-ylmethanone |
| InChIKey | NULMBVQLHKQESS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C2=CC=CS2)C |
Computed by PubChem (NCBI)