CAS 915923-80-7 appears in our catalog under these names: (3,4-Dimethylphenyl)(2-thienyl)methanone, 95%, (3,4-Dimethylphenyl)(thiophen-2-yl)methanone 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg.
(3,4-dimethylphenyl)-thiophen-2-ylmethanone (CAS 915923-80-7) is a chemical compound with the molecular formula C13H12OS and a molecular weight of 216.30 g/mol. IUPAC name: (3,4-dimethylphenyl)-thiophen-2-ylmethanone. InChIKey: NULMBVQLHKQESS-UHFFFAOYSA-N.
| Molecular formula | C13H12OS |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | (3,4-dimethylphenyl)-thiophen-2-ylmethanone |
| InChIKey | NULMBVQLHKQESS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C2=CC=CS2)C |
Computed by PubChem (NCBI)