CAS 912760-71-5 appears in our catalog under these names: 2'(2-Thienylidene)-4-methylacetophenone, 95%, 2'(2-Thienylidene)-4-methylacetophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g, 2g, 25g.
(2E)-1-(4-methylphenyl)-2-(3H-thiophen-2-ylidene)ethanone (CAS 912760-71-5) is a chemical compound with the molecular formula C13H12OS and a molecular weight of 216.30 g/mol. IUPAC name: (2E)-1-(4-methylphenyl)-2-(3H-thiophen-2-ylidene)ethanone. InChIKey: PVJIXKBKBXKUDM-FMIVXFBMSA-N.
| Molecular formula | C13H12OS |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | (2E)-1-(4-methylphenyl)-2-(3H-thiophen-2-ylidene)ethanone |
| InChIKey | PVJIXKBKBXKUDM-FMIVXFBMSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)/C=C/2\CC=CS2 |
Computed by PubChem (NCBI)