CAS 893737-03-6 is the registry number for 3-(4-Methylthiophenyl)phenol, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-(4-methylsulfanylphenyl)phenol (CAS 893737-03-6) is a chemical compound with the molecular formula C13H12OS and a molecular weight of 216.30 g/mol. IUPAC name: 3-(4-methylsulfanylphenyl)phenol. InChIKey: CYAMPGMNFHKIQR-UHFFFAOYSA-N.
| Molecular formula | C13H12OS |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | 3-(4-methylsulfanylphenyl)phenol |
| InChIKey | CYAMPGMNFHKIQR-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)