Products 30519-03-0
CAS 30519-03-0 appears in our catalog under these names: 4-(Benzylsulfanyl)phenol, 96%, 4–(Benzylthio)phenol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg.
4-benzylsulfanylphenol (CAS 30519-03-0) is a chemical compound with the molecular formula C13H12OS and a molecular weight of 216.30 g/mol. IUPAC name: 4-benzylsulfanylphenol. InChIKey: UXMOBLWTCSCLLR-UHFFFAOYSA-N.
| Molecular formula | C13H12OS |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | 4-benzylsulfanylphenol |
| InChIKey | UXMOBLWTCSCLLR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)