cas: 915030-48-7 — see every product listed under this CAS number, including other names
(3,4-difluorophenyl)difluoroacetic acid, ≥95%, ≥95% (CAS 915030-48-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DEX4-1g |
| cas | 915030-48-7 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1192.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-(3,4-difluorophenyl)-2,2-difluoroacetic acid (CAS 915030-48-7) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-2,2-difluoroacetic acid. InChIKey: YRUJIZVSJXMXLU-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-2,2-difluoroacetic acid |
| InChIKey | YRUJIZVSJXMXLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)(F)F)F)F |
Computed by PubChem (NCBI)