CAS 1823327-58-7 appears in our catalog under these names: 2-Fluoro-6-hydroxy-4-(trifluoromethyl)benzaldehyde, 95%, 2-Fluoro-6-hydroxy-4-(trifluoromethyl)benzaldehyde 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
2-fluoro-6-hydroxy-4-(trifluoromethyl)benzaldehyde (CAS 1823327-58-7) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-fluoro-6-hydroxy-4-(trifluoromethyl)benzaldehyde. InChIKey: YILPZJHXOUTDQW-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-fluoro-6-hydroxy-4-(trifluoromethyl)benzaldehyde |
| InChIKey | YILPZJHXOUTDQW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)C=O)F)C(F)(F)F |
Computed by PubChem (NCBI)