Products 915030-48-7
CAS 915030-48-7 appears in our catalog under these names: (3,4-difluorophenyl)difluoroacetic acid, 95%, 2-(3,4-Difluorophenyl)-2,2-difluoroacetic Acid, 95%, 2-(3,4-Difluorophenyl)-2,2-difluoroacetic acid, (3,4-difluorophenyl)difluoroacetic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
2-(3,4-difluorophenyl)-2,2-difluoroacetic acid (CAS 915030-48-7) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-2,2-difluoroacetic acid. InChIKey: YRUJIZVSJXMXLU-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-2,2-difluoroacetic acid |
| InChIKey | YRUJIZVSJXMXLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)(F)F)F)F |
Computed by PubChem (NCBI)