CAS 94767-47-2 is the registry number for 2,2,3,3-tetrafluoro-1,4-benzodioxine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,2,3,3-tetrafluoro-1,4-benzodioxine (CAS 94767-47-2) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2,2,3,3-tetrafluoro-1,4-benzodioxine. InChIKey: QLCDBPBUHSKXHY-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2,2,3,3-tetrafluoro-1,4-benzodioxine |
| InChIKey | QLCDBPBUHSKXHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)OC(C(O2)(F)F)(F)F |
Computed by PubChem (NCBI)