Products 5292-42-2
CAS 5292-42-2 appears in our catalog under these names: Methyl 2,3,4,5-tetrafluorobenzoate, 95%, Methyl 2，3，4，5–tetrafluorobenzoate, Methyl 2,3,4,5-tetrafluorobenzoate 97%, Methyl 2,3,4,5-tetrafluorobenzoate, 97%, 97%, Methyl 2,3,4,5-tetrafluorobenzoate, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100g, 10g.
Methyl 2,3,4,5-tetrafluorobenzoate (CAS 5292-42-2) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: methyl 2,3,4,5-tetrafluorobenzoate. InChIKey: MAEQYZYOSFAUAF-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | methyl 2,3,4,5-tetrafluorobenzoate |
| InChIKey | MAEQYZYOSFAUAF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1F)F)F)F |
Computed by PubChem (NCBI)
Synonyms:
Methyl 2,3,4,5-tetrafluorobenzoate, 2,3,4,5-tetrafluoro-benzoic acid methyl ester, Benzoic acid, 2,3,4,5-tetrafluoro-, methyl ester, 2,3,4,5-tetrafluorobenzoic acid methyl ester, Methyl 2H-tetrafluorobenzoate, Methyl2,3,4,5-tetrafluorobenzoate, Methyl 2,3,4,5-tetrafluorobenzoate #, 2,3,4,5tetrafluorobenzoic acid methyl ester, 3,4,5,6-tetrafluorobenzoic acid methyl ester