CAS 5292-42-2 appears in our catalog under these names: Methyl 2,3,4,5-tetrafluorobenzoate, 95%, Methyl 2,3,4,5–tetrafluorobenzoate, Methyl 2,3,4,5-tetrafluorobenzoate, 97%, 97%, Methyl 2,3,4,5-tetrafluorobenzoate, 98%, Methyl 2,3,4,5-tetrafluorobenzoate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 25g, 100g, 10g.
Methyl 2,3,4,5-tetrafluorobenzoate (CAS 5292-42-2) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: methyl 2,3,4,5-tetrafluorobenzoate. InChIKey: MAEQYZYOSFAUAF-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | methyl 2,3,4,5-tetrafluorobenzoate |
| InChIKey | MAEQYZYOSFAUAF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1F)F)F)F |
Computed by PubChem (NCBI)