cas: 1218790-62-5 — see every product listed under this CAS number, including other names
(3,5-Dichloro-4-isopropoxyphenyl)boronic acid 97% (CAS 1218790-62-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A457697-250mg |
| cas | 1218790-62-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 826.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A457697 |
(3,5-dichloro-4-propan-2-yloxyphenyl)boronic acid (CAS 1218790-62-5) is a chemical compound with the molecular formula C9H11BCl2O3 and a molecular weight of 248.90 g/mol. IUPAC name: (3,5-dichloro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: OTEROWRZDFNANP-UHFFFAOYSA-N.
| Molecular formula | C9H11BCl2O3 |
|---|---|
| Molecular weight | 248.90 g/mol |
| IUPAC name | (3,5-dichloro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | OTEROWRZDFNANP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OC(C)C)Cl)(O)O |
Computed by PubChem (NCBI)