cas: 1218790-62-5 — see every product listed under this CAS number, including other names
3,5-Dichloro-4-isopropoxyphenylboronic acid, 97%, 97% (CAS 1218790-62-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11270I-250mg |
| cas | 1218790-62-5 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1634.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3,5-dichloro-4-propan-2-yloxyphenyl)boronic acid (CAS 1218790-62-5) is a chemical compound with the molecular formula C9H11BCl2O3 and a molecular weight of 248.90 g/mol. IUPAC name: (3,5-dichloro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: OTEROWRZDFNANP-UHFFFAOYSA-N.
| Molecular formula | C9H11BCl2O3 |
|---|---|
| Molecular weight | 248.90 g/mol |
| IUPAC name | (3,5-dichloro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | OTEROWRZDFNANP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OC(C)C)Cl)(O)O |
Computed by PubChem (NCBI)