cas: 1459778-94-9 — see every product listed under this CAS number, including other names
(3,5-Difluoro-4-(trifluoromethyl)phenyl)boronic acid 95% (CAS 1459778-94-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A573473-100mg |
| cas | 1459778-94-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 820.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A573473 |
[3,5-difluoro-4-(trifluoromethyl)phenyl]boronic acid (CAS 1459778-94-9) is a chemical compound with the molecular formula C7H4BF5O2 and a molecular weight of 225.91 g/mol. IUPAC name: [3,5-difluoro-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: NYRAVQWKXFRDNS-UHFFFAOYSA-N.
| Molecular formula | C7H4BF5O2 |
|---|---|
| Molecular weight | 225.91 g/mol |
| IUPAC name | [3,5-difluoro-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | NYRAVQWKXFRDNS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)C(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)