Products 2096332-61-3

CAS 2096332-61-3 appears in our catalog under these names: 2,3-Difluoro-4-(trifluoromethyl)benzeneboronic acid, 96%, (2,3-Difluoro-4-(trifluoromethyl)phenyl)boronic acid 96%, 2,3-Difluoro-4-(trifluoromethyl)benzeneboronic acid, 96%, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

[2,3-difluoro-4-(trifluoromethyl)phenyl]boronic acid (CAS 2096332-61-3) is a chemical compound with the molecular formula C7H4BF5O2 and a molecular weight of 225.91 g/mol. IUPAC name: [2,3-difluoro-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: KFZQEXGUUYWITP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BF5O2
Molecular weight225.91 g/mol
IUPAC name[2,3-difluoro-4-(trifluoromethyl)phenyl]boronic acid
InChIKeyKFZQEXGUUYWITP-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)C(F)(F)F)F)F)(O)O

Computed by PubChem (NCBI)