Products 2377611-31-7

CAS 2377611-31-7 is the registry number for 2,3-Difluoro-5-(trifluoromethyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

[2,3-difluoro-5-(trifluoromethyl)phenyl]boronic acid (CAS 2377611-31-7) is a chemical compound with the molecular formula C7H4BF5O2 and a molecular weight of 225.91 g/mol. IUPAC name: [2,3-difluoro-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: VIRKYBWEZSTTRV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BF5O2
Molecular weight225.91 g/mol
IUPAC name[2,3-difluoro-5-(trifluoromethyl)phenyl]boronic acid
InChIKeyVIRKYBWEZSTTRV-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1F)F)C(F)(F)F)(O)O

Computed by PubChem (NCBI)