CAS 2377611-31-7 is the registry number for 2,3-Difluoro-5-(trifluoromethyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
[2,3-difluoro-5-(trifluoromethyl)phenyl]boronic acid (CAS 2377611-31-7) is a chemical compound with the molecular formula C7H4BF5O2 and a molecular weight of 225.91 g/mol. IUPAC name: [2,3-difluoro-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: VIRKYBWEZSTTRV-UHFFFAOYSA-N.
| Molecular formula | C7H4BF5O2 |
|---|---|
| Molecular weight | 225.91 g/mol |
| IUPAC name | [2,3-difluoro-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | VIRKYBWEZSTTRV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)