Products 769937-40-8

CAS 769937-40-8 appears in our catalog under these names: [2,4-Difluoro-3-(trifluoromethyl)phenyl]boronic acid, 98%, (2,4-Difluoro-3-(trifluoromethyl)phenyl)boronic acid 98%, [2,4-Difluoro-3-(trifluoromethyl)phenyl]boronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

[2,4-difluoro-3-(trifluoromethyl)phenyl]boronic acid (CAS 769937-40-8) is a chemical compound with the molecular formula C7H4BF5O2 and a molecular weight of 225.91 g/mol. IUPAC name: [2,4-difluoro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: UKIVSWMRVQEICY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BF5O2
Molecular weight225.91 g/mol
IUPAC name[2,4-difluoro-3-(trifluoromethyl)phenyl]boronic acid
InChIKeyUKIVSWMRVQEICY-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)F)C(F)(F)F)F)(O)O

Computed by PubChem (NCBI)