CAS 864759-64-8 appears in our catalog under these names: 3,4-Difluoro-5-trifluoromethylphenylboronic acid, 97%, (3,4-Difluoro-5-(trifluoromethyl)phenyl)boronic acid, 98%, 3,4-Difluoro-5-trifluoromethylphenylboronic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
[3,4-difluoro-5-(trifluoromethyl)phenyl]boronic acid (CAS 864759-64-8) is a chemical compound with the molecular formula C7H4BF5O2 and a molecular weight of 225.91 g/mol. IUPAC name: [3,4-difluoro-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: LPOLDWSSSVLGJH-UHFFFAOYSA-N.
| Molecular formula | C7H4BF5O2 |
|---|---|
| Molecular weight | 225.91 g/mol |
| IUPAC name | [3,4-difluoro-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | LPOLDWSSSVLGJH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)