(3,5-Diformylphenyl)boronic acid, 96%
cas: 480424-62-2 — see every product listed under this CAS number, including other names
(3,5-Diformylphenyl)boronic acid, 96% (CAS 480424-62-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 2.5g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114INA-100mg |
| cas | 480424-62-2 |
| size | 100mg |
| availability | 45g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 875.60 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1070.47 Pln | |
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 2.5g | 888.25 Pln | |
| Fluorochem | 25g | 3949.67 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(3,5-diformylphenyl)boronic acid (CAS 480424-62-2) is a chemical compound with the molecular formula C8H7BO4 and a molecular weight of 177.95 g/mol. IUPAC name: (3,5-diformylphenyl)boronic acid. InChIKey: RIFBPKDFVPXQQH-UHFFFAOYSA-N.
| Molecular formula | C8H7BO4 |
|---|---|
| Molecular weight | 177.95 g/mol |
| IUPAC name | (3,5-diformylphenyl)boronic acid |
| InChIKey | RIFBPKDFVPXQQH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C=O)C=O)(O)O |
Computed by PubChem (NCBI)