cas: 957060-98-9 — see every product listed under this CAS number, including other names
(3-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid (CAS 957060-98-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IZ7-1g |
| cas | 957060-98-9 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 390.80 Pln |
| delivery time | 3 weeks |
|---|
[3-[(2,4-dimethylphenyl)carbamoyl]phenyl]boronic acid (CAS 957060-98-9) is a chemical compound with the molecular formula C15H16BNO3 and a molecular weight of 269.11 g/mol. IUPAC name: [3-[(2,4-dimethylphenyl)carbamoyl]phenyl]boronic acid. InChIKey: ZVBRLWSDAGYMQQ-UHFFFAOYSA-N.
| Molecular formula | C15H16BNO3 |
|---|---|
| Molecular weight | 269.11 g/mol |
| IUPAC name | [3-[(2,4-dimethylphenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | ZVBRLWSDAGYMQQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=C(C=C(C=C2)C)C)(O)O |
Computed by PubChem (NCBI)