CAS 957060-98-9 appears in our catalog under these names: 3-Borono-N-(2,4-dimethylphenyl)benzamide, 98%, (3-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid, 98%, (3-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid, (3-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 500g, 1g, 250mg.
[3-[(2,4-dimethylphenyl)carbamoyl]phenyl]boronic acid (CAS 957060-98-9) is a chemical compound with the molecular formula C15H16BNO3 and a molecular weight of 269.11 g/mol. IUPAC name: [3-[(2,4-dimethylphenyl)carbamoyl]phenyl]boronic acid. InChIKey: ZVBRLWSDAGYMQQ-UHFFFAOYSA-N.
| Molecular formula | C15H16BNO3 |
|---|---|
| Molecular weight | 269.11 g/mol |
| IUPAC name | [3-[(2,4-dimethylphenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | ZVBRLWSDAGYMQQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=C(C=C(C=C2)C)C)(O)O |
Computed by PubChem (NCBI)