CAS 874219-49-5 appears in our catalog under these names: 4-(Benzyl(methyl)carbamoyl)phenylboronic acid, 96%, (4-(Methyl(Phenyl)Carbamoyl)Phenyl)Boronic Acid, 98%, 98%, (4-(Benzyl(methyl)carbamoyl)phenyl)boronic acid, 98%, (4-(Methyl(phenyl)carbamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg, 10g.
[4-[benzyl(methyl)carbamoyl]phenyl]boronic acid (CAS 874219-49-5) is a chemical compound with the molecular formula C15H16BNO3 and a molecular weight of 269.11 g/mol. IUPAC name: [4-[benzyl(methyl)carbamoyl]phenyl]boronic acid. InChIKey: LPRWGAHHEXCVJU-UHFFFAOYSA-N.
| Molecular formula | C15H16BNO3 |
|---|---|
| Molecular weight | 269.11 g/mol |
| IUPAC name | [4-[benzyl(methyl)carbamoyl]phenyl]boronic acid |
| InChIKey | LPRWGAHHEXCVJU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)N(C)CC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)