CAS 913835-36-6 appears in our catalog under these names: N-(2,3-Dimethylphenyl) 4-boronobenzamide, 98%, N-(2,3-Dimethylphenyl) 4-boronobenzamide, 98%, 98%, (4-((2,3-Dimethylphenyl)carbamoyl)phenyl)boronic acid, 98%, 4-(2,3-Dimethylphenylcarbamoyl)phenylboronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 100g, 1g, 250mg.
[4-[(2,3-dimethylphenyl)carbamoyl]phenyl]boronic acid (CAS 913835-36-6) is a chemical compound with the molecular formula C15H16BNO3 and a molecular weight of 269.11 g/mol. IUPAC name: [4-[(2,3-dimethylphenyl)carbamoyl]phenyl]boronic acid. InChIKey: XMQJSFXFADVYRR-UHFFFAOYSA-N.
| Molecular formula | C15H16BNO3 |
|---|---|
| Molecular weight | 269.11 g/mol |
| IUPAC name | [4-[(2,3-dimethylphenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | XMQJSFXFADVYRR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=CC=CC(=C2C)C)(O)O |
Computed by PubChem (NCBI)